N-Acetyl-L-methionine N-Acetyl-L-methionine

Structural formula

Business number	01DY
Molecular formula	C7H13NO3S
Molecular weight	191.25
label	N-acetyl L-methionine, CH3SCH2CH2CH(NHCOCH3)CO2H

• Numbering system
• Physical property data
• Toxicological data
• Ecological data
• Molecular structure data
• Computing chemical data
• More
  • Properties and Stability
  • Storage method
  • Synthesis method
  • Purpose

Numbering system

CAS number:65-82-7

MDL number:MFCD00064441

EINECS number:200-617-7

RTECS number:PD0480000

BRN number:1725552

PubChem number:24845156

Physical property data

1. Character:Colorless or glossy white crystals or white powder. Odorless or nearly odorless

2. Density (g/mL,25/4℃): Unsure

3. Relative vapor density (g/mL,AIR=1): Unsure

4. Melting point (ºC):103 -106

5. Boiling point (ºC,Normal pressure): Uncertain

6. Boiling point (ºC, 5.2kPa): Unsure

7. Refractive index:-21 ° (C=1, H2O)

8. Flash point (ºC): Unsure

9. Specific optical rotation (º):-20 º (c=4 H2O)

10. Autoignition point or ignition temperature (ºC): Unsure

11. Vapor pressure (kPa,25ºC): Unsure

12. 17. Explosion upper limit (%,V/V): Unsure

18. Lower explosion limit (%,V/V): Unsure

19. Solubility:Soluble in water, ethanol, alkaline solution and dilute inorganic acid, almost insoluble in ether

Toxicological data

Acute toxicity: Mouse intravenous LD50: 435 mg/kg;

Ecological data

None yet

Molecular structure data

1. Molar refractive index:47.62

2. Molar volume (m³/mol）：158.9

3. isotonic specific volume (90.2K):413.5

4. Surface Tension (dyne/cm):45.7

5. Polarizability（10^-24cm³):18.87

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 2

3. Number of hydrogen bond acceptors: 4

4. Number of rotatable chemical bonds: 5

5. Number of tautomers: 2

6. Topological molecule polar surface area 91.7

7. Number of heavy atoms: 12

8. Surface charge: 0

9. Complexity: 172

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 1

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None yet

Storage method

ByL-Methionine is acetylated with excess acetic acid or acetic anhydride .

Synthesis method

None yet

Purpose

Nutritional supplements.

” align=left> 3. Isotonic specific volume (90.2K):413.5

4. Surface Tension (dyne/cm):45.7

5. Polarizability（10^-24cm³):18.87

Compute chemical data

1. Reference value for hydrophobic parameter calculation (XlogP): None

2. Number of hydrogen bond donors: 2

3. Number of hydrogen bond acceptors: 4

4. Number of rotatable chemical bonds: 5

5. Number of tautomers: 2

6. Topological molecule polar surface area 91.7

7. Number of heavy atoms: 12

8. Surface charge: 0

9. Complexity: 172

10. Number of isotope atoms: 0

11. Determine the number of atomic stereocenters: 1

12. Uncertain number of atomic stereocenters: 0

13. Determine the number of chemical bond stereocenters: 0

14. Number of uncertain chemical bond stereocenters: 0

15. Number of covalent bond units: 1

Properties and stability

None yet

Storage method

ByL-Methionine is acetylated with excess acetic acid or acetic anhydride .

Synthesis method

None yet

Purpose

Nutritional supplements.